4-Br-Buphedrone
1-(4-Bromophenyl)-2-(methylamino)butan-1-one
 8540  C11H14BrNO  256.139
 InChI=1S/C11H14BrNO/c1-3-10(13-2)11(14)8-4-6-9(12)7-5-8/h4-7,10,13H,3H2,1-2H3
 VZZUCBJDWGOVRA-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCC(C(=O)c1ccc(cc1)Br)NC