3-FPBP
1-(3-Fluorophenyl)-2-(pyrrolidin-1-yl)butan-1-one
 8531 C14H18FNO 235.297
 InChI=1S/C14H18FNO/c1-2-13(16-8-3-4-9-16)14(17)11-6-5-7-12(15)10-11/h5-7,10,13H,2-4,8-9H2,1H3
 BNWVPQUXMCPQAU-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCC(C(=O)c1cccc(c1)F)N1CCCC1