3-FPPP
1-(3-Fluorophenyl)-2-(pyrrolidin-1-yl)propan-1-one
 8530 C13H16FNO 221.271
 InChI=1S/C13H16FNO/c1-10(15-7-2-3-8-15)13(16)11-5-4-6-12(14)9-11/h4-6,9-10H,2-3,7-8H2,1H3
 ULCYWOZDRYWKHX-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 Fc1cccc(c1)C(=O)C(N1CCCC1)C