N-Methyl-hexylone
1-(2H-1,3-Benzodioxol-5-yl)-2-(methylamino)hexan-1-one
 8525  C14H19NO3  249.306
 InChI=1S/C14H19NO3/c1-3-4-5-11(15-2)14(16)10-6-7-12-13(8-10)18-9-17-12/h6-8,11,15H,3-5,9H2,1-2H3
 LNZBSVNIMBHSAG-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCCCC(C(=O)c1ccc2c(c1)OCO2)NC