Octedrone
2-(Methylamino)-1-phenyloctan-1-one
 8502 C15H23NO 233.349
 InChI=1S/C15H23NO/c1-3-4-5-9-12-14(16-2)15(17)13-10-7-6-8-11-13/h6-8,10-11,14,16H,3-5,9,12H2,1-2H3
 UEBUEWINLAAZDU-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCCCCCC(C(=O)c1ccccc1)NC