QH-ii-063
7-Bromo-1-methyl-5-phenyl-1,3-dihydro-2H-1,4-benzodiazepin-2-one
 8259 C16H13BrN2O 329.191
 Aryldiazepine
 InChI=1S/C16H13BrN2O/c1-19-14-8-7-12(17)9-13(14)16(18-10-15(19)20)11-5-3-2-4-6-11/h2-9H,10H2,1H3
 FLEQTIDRWGGTRR-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 Brc1ccc2c(c1)C(=NCC(=O)N2C)c1ccccc1