JC-184
7-Bromo-5-(thiophen-2-yl)-1,3-dihydro-2H-1,4-benzodiazepin-2-one
 8257 C13H9BrN2OS 321.192
 Aryldiazepine
 InChI=1S/C13H9BrN2OS/c14-8-3-4-10-9(6-8)13(11-2-1-5-18-11)15-7-12(17)16-10/h1-6H,7H2,(H,16,17)
 NDRIGBBYESLCNN-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 O=C1CN=C(c2c(N1)ccc(c2)Br)c1cccs1