DM-ii-20
2,2,2-Trifluoroethyl 8-ethynyl-6-phenyl-4H-imidazo[1,5-a][1,4]benzodiazepine-3-carboxylate
 8245 C22H14F3N3O2 409.361
 Aryldiazepine
 InChI=1S/C22H14F3N3O2/c1-2-14-8-9-17-16(10-14)19(15-6-4-3-5-7-15)26-11-18-20(27-13-28(17)18)21(29)30-12-22(23,24)25/h1,3-10,13H,11-12H2
 JETOHYBAXFEENY-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 C#Cc1ccc2c(c1)C(=NCc1n2cnc1C(=O)OCC(F)(F)F)c1ccccc1