HJ-i-037
8-Ethynyl-6-(2-fluorophenyl)-N-methyl-4H-imidazo[1,5-a][1,4]benzodiazepine-3-carboxamide
 8240 C21H15FN4O 358.368
 Aryldiazepine
 InChI=1S/C21H15FN4O/c1-3-13-8-9-17-15(10-13)19(14-6-4-5-7-16(14)22)24-11-18-20(21(27)23-2)25-12-26(17)18/h1,4-10,12H,11H2,2H3,(H,23,27)
 SELNKEOOGMXJFY-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CNC(=O)c1ncn2c1CN=C(c1c2ccc(c1)C#C)c1ccccc1F