MIDD-0301
(4R)-8-Bromo-6-(2-fluorophenyl)-4-methyl-4H-imidazo[1,5-a][1,4]benzodiazepine-3-carboxylic acid
 8236 C19H13BrFN3O2 414.228
 Aryldiazepine
 InChI=1S/C19H13BrFN3O2/c1-10-18-17(19(25)26)22-9-24(18)15-7-6-11(20)8-13(15)16(23-10)12-4-2-3-5-14(12)21/h2-10H,1H3,(H,25,26)/t10-/m1/s1
 OSBXEAZWQGBYFU-SNVBAGLBSA-N This stereoisomer Any stereoisomer
 Brc1ccc2c(c1)C(=N[C@@H](c1n2cnc1C(=O)O)C)c1ccccc1F