JC-222
7-Ethynyl-1-methyl-5-(thiophen-2-yl)-1,3-dihydro-2H-1,4-benzodiazepin-2-one
 8234 C16H12N2OS 280.344
 Aryldiazepine
 InChI=1S/C16H12N2OS/c1-3-11-6-7-13-12(9-11)16(14-5-4-8-20-14)17-10-15(19)18(13)2/h1,4-9H,10H2,2H3
 GUDWQPNYVVJOTI-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 C#Cc1ccc2c(c1)C(=NCC(=O)N2C)c1cccs1