JY-i-60
7-Ethynyl-5-(2-fluorophenyl)-1,3-dihydro-2H-1,4-benzodiazepin-2-one
 8232 C17H11FN2O 278.28
 Aryldiazepine
 InChI=1S/C17H11FN2O/c1-2-11-7-8-15-13(9-11)17(19-10-16(21)20-15)12-5-3-4-6-14(12)18/h1,3-9H,10H2,(H,20,21)
 UXUCXISRVGPAJU-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 C#Cc1ccc2c(c1)C(=NCC(=O)N2)c1ccccc1F