JY-i-32
Ethyl 8-bromo-6-(2-fluorophenyl)-4H-imidazo[1,5-a][1,4]benzodiazepine-3-carboxylate
 8225 C20H15BrFN3O2 428.254
 Aryldiazepine
 InChI=1S/C20H15BrFN3O2/c1-2-27-20(26)19-17-10-23-18(13-5-3-4-6-15(13)22)14-9-12(21)7-8-16(14)25(17)11-24-19/h3-9,11H,2,10H2,1H3
 JGOKTFDESDCCSH-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCOC(=O)c1ncn2c1CN=C(c1c2ccc(c1)Br)c1ccccc1F