GL-ii-54
(4R)-8-Bromo-4-methyl-3-(3-methyl-1,2,4-oxadiazol-5-yl)-6-(pyridin-2-yl)-4H-imidazo[1,5-a][1,4]benzodiazepine
 8222 C20H15BrN6O 435.277
 Aryldiazepine
 InChI=1S/C20H15BrN6O/c1-11-19-18(20-25-12(2)26-28-20)23-10-27(19)16-7-6-13(21)9-14(16)17(24-11)15-5-3-4-8-22-15/h3-11H,1-2H3/t11-/m1/s1
 FFVVHHGTBSWVRT-LLVKDONJSA-N This stereoisomer Any stereoisomer
 Brc1ccc2c(c1)C(=N[C@@H](c1n2cnc1c1onc(n1)C)C)c1ccccn1