GL-iii-23
8-Ethynyl-6-(2-fluorophenyl)-3-(3-methyl-1,2,4-oxadiazol-5-yl)-4H-imidazo[1,5-a][1,4]benzodiazepine
 8221 C22H14FN5O 383.378
 Aryldiazepine
 InChI=1S/C22H14FN5O/c1-3-14-8-9-18-16(10-14)20(15-6-4-5-7-17(15)23)24-11-19-21(25-12-28(18)19)22-26-13(2)27-29-22/h1,4-10,12H,11H2,2H3
 SPZBDNXRZQBVID-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 C#Cc1ccc2c(c1)C(=NCc1n2cnc1c1onc(n1)C)c1ccccc1F