HZ-166
Ethyl 8-ethynyl-6-(pyridin-2-yl)-4H-imidazo[1,5-a][1,4]benzodiazepine-3-carboxylate
 8217 C21H16N4O2 356.377
 Aryldiazepine
 InChI=1S/C21H16N4O2/c1-3-14-8-9-17-15(11-14)19(16-7-5-6-10-22-16)23-12-18-20(21(26)27-4-2)24-13-25(17)18/h1,5-11,13H,4,12H2,2H3
 ZSEDMNMFODMQRD-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCOC(=O)c1ncn2c1CN=C(c1c2ccc(c1)C#C)c1ccccn1