GL-ii-19-2′N-R-CH3
Ethyl (4R)-8-ethynyl-4-methyl-6-(pyridin-2-yl)-4H-imidazo[1,5-a][1,4]benzodiazepine-3-carboxylate
 8216 C22H18N4O2 370.404
 Aryldiazepine
 InChI=1S/C22H18N4O2/c1-4-15-9-10-18-16(12-15)19(17-8-6-7-11-23-17)25-14(3)21-20(22(27)28-5-2)24-13-26(18)21/h1,6-14H,5H2,2-3H3/t14-/m1/s1
 HLYKFXWUSDXGFJ-CQSZACIVSA-N This stereoisomer Any stereoisomer
 CCOC(=O)c1ncn2c1[C@@H](C)N=C(c1c2ccc(c1)C#C)c1ccccn1