GL-ii-31
(4R)-8-Ethynyl-N,4-dimethyl-6-(pyridin-2-yl)-4H-imidazo[1,5-a][1,4]benzodiazepine-3-carboxamide
 8214 C21H17N5O 355.393
 Aryldiazepine
 InChI=1S/C21H17N5O/c1-4-14-8-9-17-15(11-14)18(16-7-5-6-10-23-16)25-13(2)20-19(21(27)22-3)24-12-26(17)20/h1,5-13H,2-3H3,(H,22,27)/t13-/m1/s1
 HFLGPJWEMDBGNG-CYBMUJFWSA-N This stereoisomer Any stereoisomer
 CNC(=O)c1ncn2c1[C@@H](C)N=C(c1c2ccc(c1)C#C)c1ccccn1