MP-iii-023
(4S)-8-Ethynyl-6-(2-fluorophenyl)-N,4-dimethyl-4H-imidazo[1,5-a][1,4]benzodiazepine-3-carboxamide
 8213 C22H17FN4O 372.395
 Aryldiazepine
 InChI=1S/C22H17FN4O/c1-4-14-9-10-18-16(11-14)19(15-7-5-6-8-17(15)23)26-13(2)21-20(22(28)24-3)25-12-27(18)21/h1,5-13H,2-3H3,(H,24,28)/t13-/m0/s1
 PIPOCLOMPZRSLC-ZDUSSCGKSA-N This stereoisomer Any stereoisomer
 CNC(=O)c1ncn2c1[C@H](C)N=C(c1c2ccc(c1)C#C)c1ccccc1F