MP-iv-004
(4R)-8-Ethynyl-6-(2-fluorophenyl)-4-methyl-3-(3-methyl-1,2,4-oxadiazol-5-yl)-4H-imidazo[1,5-a][1,4]benzodiazepine
 8212 C23H16FN5O 397.404
 Aryldiazepine
 InChI=1S/C23H16FN5O/c1-4-15-9-10-19-17(11-15)20(16-7-5-6-8-18(16)24)26-13(2)22-21(25-12-29(19)22)23-27-14(3)28-30-23/h1,5-13H,2-3H3/t13-/m1/s1
 YIYOQBKUWVSTNV-CYBMUJFWSA-N This stereoisomer Any stereoisomer
 C#Cc1ccc2c(c1)C(=N[C@@H](c1n2cnc1c1onc(n1)C)C)c1ccccc1F