MP-ii-080
3-(3-Ethyl-1,2,4-oxadiazol-5-yl)-8-ethynyl-6-(pyridin-2-yl)-4H-imidazo[1,5-a][1,4]benzodiazepine
 8209 C22H16N6O 380.402
 Aryldiazepine
 InChI=1S/C22H16N6O/c1-3-14-8-9-17-15(11-14)20(16-7-5-6-10-23-16)24-12-18-21(25-13-28(17)18)22-26-19(4-2)27-29-22/h1,5-11,13H,4,12H2,2H3
 SGYGRQNNQWTBRU-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCc1noc(n1)c1ncn2c1CN=C(c1c2ccc(c1)C#C)c1ccccn1