MP-ii-065
8-Ethynyl-6-(pyridin-2-yl)-4H-imidazo[1,5-a][1,4]benzodiazepine-3-carboxamide
 8208 C19H13N5O 327.339
 Aryldiazepine
 InChI=1S/C19H13N5O/c1-2-12-6-7-15-13(9-12)17(14-5-3-4-8-21-14)22-10-16-18(19(20)25)23-11-24(15)16/h1,3-9,11H,10H2,(H2,20,25)
 BGYVDFYYQYICIR-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 C#Cc1ccc2c(c1)C(=NCc1n2cnc1C(=O)N)c1ccccn1