GL-ii-76
[(4R)-8-Ethynyl-6-(2-fluorophenyl)-4-methyl-4H-imidazo[1,5-a][1,4]benzodiazepin-3-yl](pyrrolidin-1-yl)methanone
 8207 C25H21FN4O 412.459
 Aryldiazepine
 InChI=1S/C25H21FN4O/c1-3-17-10-11-21-19(14-17)22(18-8-4-5-9-20(18)26)28-16(2)24-23(27-15-30(21)24)25(31)29-12-6-7-13-29/h1,4-5,8-11,14-16H,6-7,12-13H2,2H3/t16-/m1/s1
 SBZLOXWLMWKDBP-MRXNPFEDSA-N This stereoisomer Any stereoisomer
 C#Cc1ccc2c(c1)C(=N[C@@H](c1n2cnc1C(=O)N1CCCC1)C)c1ccccc1F