GL-ii-75
(4R)-N-Cyclopropyl-8-ethynyl-6-(2-fluorophenyl)-4-methyl-4H-imidazo[1,5-a][1,4]benzodiazepine-3-carboxamide
 8206 C24H19FN4O 398.432
 Aryldiazepine
 InChI=1S/C24H19FN4O/c1-3-15-8-11-20-18(12-15)21(17-6-4-5-7-19(17)25)27-14(2)23-22(26-13-29(20)23)24(30)28-16-9-10-16/h1,4-8,11-14,16H,9-10H2,2H3,(H,28,30)/t14-/m1/s1
 YLZWVRAOJGXWTI-CQSZACIVSA-N This stereoisomer Any stereoisomer
 C#Cc1ccc2c(c1)C(=N[C@@H](c1n2cnc1C(=O)NC1CC1)C)c1ccccc1F