N-Cyanoethylfentanyl
N-[1-(2-Cyanoethyl)piperidin-4-yl]-N-phenylpropanamide
 8186 C17H23N3O 285.384
 Fentanyl
 InChI=1S/C17H23N3O/c1-2-17(21)20(15-7-4-3-5-8-15)16-9-13-19(14-10-16)12-6-11-18/h3-5,7-8,16H,2,6,9-10,12-14H2,1H3
 AMBTUOJRPJZOOM-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 N#CCCN1CCC(CC1)N(c1ccccc1)C(=O)CC