Quipazine
2-(Piperazin-1-yl)quinoline
 815 C13H15N3 213.278
 InChI=1S/C13H15N3/c1-2-4-12-11(3-1)5-6-13(15-12)16-9-7-14-8-10-16/h1-6,14H,7-10H2
 XRXDAJYKGWNHTQ-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 N1CCN(CC1)c1ccc2c(n1)cccc2