1-NP
1-(Naphthalen-1-yl)piperazine
 814 C14H16N2 212.29
 InChI=1S/C14H16N2/c1-2-6-13-12(4-1)5-3-7-14(13)16-10-8-15-9-11-16/h1-7,15H,8-11H2
 VNICFCQJUVFULD-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 N1CCN(CC1)c1cccc2c1cccc2