HOPP
4-(Piperazin-1-yl)phenol
 810 C10H14N2O 178.231
 InChI=1S/C10H14N2O/c13-10-3-1-9(2-4-10)12-7-5-11-6-8-12/h1-4,11,13H,5-8H2
 GPEOAEVZTOQXLG-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 Oc1ccc(cc1)N1CCNCC1