HO-mCPP
2-Chloro-4-(piperazin-1-yl)phenol
 807 C10H13ClN2O 212.676
 InChI=1S/C10H13ClN2O/c11-9-7-8(1-2-10(9)14)13-5-3-12-4-6-13/h1-2,7,12,14H,3-6H2
 FXECOYYRPDGOQB-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 Oc1ccc(cc1Cl)N1CCNCC1