DOM-DFLY
1-(8-Methylbenzo[1,2-b:4,5-b′]difuran-4-yl)propan-2-amine
 7928 C14H15NO2 229.274
 InChI=1S/C14H15NO2/c1-8(15)7-12-11-4-6-16-13(11)9(2)10-3-5-17-14(10)12/h3-6,8H,7,15H2,1-2H3
 IXFHANOMNSVFQJ-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CC(Cc1c2occc2c(c2c1cco2)C)N