I-DFLY
1-(8-Iodobenzo[1,2-b:4,5-b′]difuran-4-yl)propan-2-amine
 7927 C13H12INO2 341.144
 InChI=1S/C13H12INO2/c1-7(15)6-10-8-2-4-17-13(8)11(14)9-3-5-16-12(9)10/h2-5,7H,6,15H2,1H3
 QSULDLYMFAOVCK-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CC(Cc1c2occc2c(c2c1cco2)I)N