2C-I-DFLY
2-(8-Iodobenzo[1,2-b:4,5-b′]difuran-4-yl)ethan-1-amine
 7926 C12H10INO2 327.118
 InChI=1S/C12H10INO2/c13-10-9-3-6-15-11(9)7(1-4-14)8-2-5-16-12(8)10/h2-3,5-6H,1,4,14H2
 MSQFWXSLQJYKQE-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 NCCc1c2occc2c(c2c1cco2)I