I-FLY
1-(8-Iodo-2,3,6,7-tetrahydrobenzo[1,2-b:4,5-b′]difuran-4-yl)propan-2-amine
 7921 C13H16INO2 345.176
 InChI=1S/C13H16INO2/c1-7(15)6-10-8-2-4-17-13(8)11(14)9-3-5-16-12(9)10/h7H,2-6,15H2,1H3
 GMFMRXXMPVGZEX-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CC(Cc1c2OCCc2c(c2c1CCO2)I)N