2C-I-FLY
2-(8-Iodo-2,3,6,7-tetrahydrobenzo[1,2-b:4,5-b′]difuran-4-yl)ethan-1-amine
 7920 C12H14INO2 331.15
 InChI=1S/C12H14INO2/c13-10-9-3-6-15-11(9)7(1-4-14)8-2-5-16-12(8)10/h1-6,14H2
 SDULYHWSVCNNAO-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 NCCc1c2OCCc2c(c2c1CCO2)I