PeMA
1-(Pentamethoxyphenyl)propan-2-amine
 7914 C14H23NO5 285.336
 InChI=1S/C14H23NO5/c1-8(15)7-9-10(16-2)12(18-4)14(20-6)13(19-5)11(9)17-3/h8H,7,15H2,1-6H3
 CDUJLDXLXICILS-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 COc1c(OC)c(CC(N)C)c(c(c1OC)OC)OC