3,4,6-Me-2,5-DMPEA
2-(2,5-Dimethoxy-3,4,6-trimethylphenyl)ethan-1-amine
 7912 C13H21NO2 223.311
 InChI=1S/C13H21NO2/c1-8-9(2)13(16-5)11(6-7-14)10(3)12(8)15-4/h6-7,14H2,1-5H3
 QJAYTSFMHSZSQD-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 NCCc1c(C)c(OC)c(c(c1OC)C)C