PeMeA
1-(Pentamethylphenyl)propan-2-amine
 7911 C14H23N 205.339
 InChI=1S/C14H23N/c1-8(15)7-14-12(5)10(3)9(2)11(4)13(14)6/h8H,7,15H2,1-6H3
 RENZAXTTWGMHHX-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CC(Cc1c(C)c(C)c(c(c1C)C)C)N