PeMePEA
2-(Pentamethylphenyl)ethan-1-amine
 7910 C13H21N 191.313
 InChI=1S/C13H21N/c1-8-9(2)11(4)13(6-7-14)12(5)10(8)3/h6-7,14H2,1-5H3
 JFLFQSJPOUSVCM-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 NCCc1c(C)c(C)c(c(c1C)C)C