TeMePEA-3
2-(2,3,5,6-Tetramethylphenyl)ethan-1-amine
 7883 C12H19N 177.286
 InChI=1S/C12H19N/c1-8-7-9(2)11(4)12(5-6-13)10(8)3/h7H,5-6,13H2,1-4H3
 YOFXEOBIEBNLKA-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 NCCc1c(C)c(C)cc(c1C)C