Ro60-0213
(2S)-1-(7-Methoxy-4,8b-dihydroindeno[1,2-b]pyrrol-1(3aH)-yl)propan-2-amine
 788  C15H20N2O  244.332
 InChI=1S/C15H20N2O/c1-10(16)9-17-6-5-12-7-11-3-4-13(18-2)8-14(11)15(12)17/h3-6,8,10,12,15H,7,9,16H2,1-2H3/t10-,12?,15?/m0/s1
 ONGPQVQZGGXAHQ-VLRKGOCCSA-N This stereoisomer Any stereoisomer
 COc1ccc2c(c1)C1N(C=CC1C2)C[C@@H](N)C