α-Oxo-iso-DMT
2-(1H-Indol-1-yl)-N,N-dimethylacetamide
 7843  C12H14N2O  202.252
 InChI=1S/C12H14N2O/c1-13(2)12(15)9-14-8-7-10-5-3-4-6-11(10)14/h3-8H,9H2,1-2H3
 APYVYDUDWLKAQE-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 O=C(N(C)C)Cn1ccc2c1cccc2