homo-iso-DMT
3-(1H-Indol-1-yl)-N,N-dimethylpropan-1-amine
 7842  C13H18N2  202.295
 InChI=1S/C13H18N2/c1-14(2)9-5-10-15-11-8-12-6-3-4-7-13(12)15/h3-4,6-8,11H,5,9-10H2,1-2H3
 VZQZKEYQPBNATK-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CN(CCCn1ccc2c1cccc2)C