2C-G-1
2-(2,5-Dimethoxybicyclo[4.1.0]hepta-1,3,5-trien-3-yl)ethan-1-amine
 7819 C11H15NO2 193.242
 InChI=1S/C11H15NO2/c1-13-10-5-7(3-4-12)11(14-2)9-6-8(9)10/h5H,3-4,6,12H2,1-2H3
 LKETZMLPWWBVIT-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 NCCc1cc(OC)c2c(c1OC)C2