G-22
1-(3,4-Diethyl-2,5-dimethoxyphenyl)propan-2-amine
 7818 C15H25NO2 251.365
 InChI=1S/C15H25NO2/c1-6-12-13(7-2)15(18-5)11(8-10(3)16)9-14(12)17-4/h9-10H,6-8,16H2,1-5H3
 MKVKXUQKHKIVHF-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 COc1cc(CC(N)C)c(c(c1CC)CC)OC