2C-G-22
2-(3,4-Diethyl-2,5-dimethoxyphenyl)ethan-1-amine
 7817 C14H23NO2 237.338
 InChI=1S/C14H23NO2/c1-5-11-12(6-2)14(17-4)10(7-8-15)9-13(11)16-3/h9H,5-8,15H2,1-4H3
 UMNFLVNSIPDSTF-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 NCCc1cc(OC)c(c(c1OC)CC)CC