G-12
1-(4-Ethyl-2,5-dimethoxy-3-methylphenyl)propan-2-amine
 7816 C14H23NO2 237.338
 InChI=1S/C14H23NO2/c1-6-12-10(3)14(17-5)11(7-9(2)15)8-13(12)16-4/h8-9H,6-7,15H2,1-5H3
 CWWCBKKGJGJGRU-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 COc1cc(CC(N)C)c(c(c1CC)C)OC