2C-G-12
2-(4-Ethyl-2,5-dimethoxy-3-methylphenyl)ethan-1-amine
 7815 C13H21NO2 223.311
 InChI=1S/C13H21NO2/c1-5-11-9(2)13(16-4)10(6-7-14)8-12(11)15-3/h8H,5-7,14H2,1-4H3
 KBRHKDVSJLRHCY-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 NCCc1cc(OC)c(c(c1OC)C)CC