2C-G-21
2-(3-Ethyl-2,5-dimethoxy-4-methylphenyl)ethan-1-amine
 7813 C13H21NO2 223.311
 InChI=1S/C13H21NO2/c1-5-11-9(2)12(15-3)8-10(6-7-14)13(11)16-4/h8H,5-7,14H2,1-4H3
 JBTNENVMKIXKCU-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 NCCc1cc(OC)c(c(c1OC)CC)C