TeMeA
1-(2,3,4,5-Tetramethylphenyl)propan-2-amine
 7810 C13H21N 191.313
 InChI=1S/C13H21N/c1-8-6-13(7-9(2)14)12(5)11(4)10(8)3/h6,9H,7,14H2,1-5H3
 PEUNRIHGWOFLDH-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CC(Cc1cc(C)c(c(c1C)C)C)N