TeMePEA
2-(2,3,4,5-Tetramethylphenyl)ethan-1-amine
 7809 C12H19N 177.286
 InChI=1S/C12H19N/c1-8-7-12(5-6-13)11(4)10(3)9(8)2/h7H,5-6,13H2,1-4H3
 RBPVKUADBVSDBA-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 NCCc1cc(C)c(c(c1C)C)C